For research use only. Not for therapeutic Use.
2-[(4-Ethylphenyl)-phenylacetyl]-indan-1,3-dione (Cat.No:M001477) is a chemical compound with potential applications in medicinal chemistry and drug development. Inquire 2-[(4-Ethylphenyl)-phenylacetyl]-indan-1,3-dione online by filling out the inquiry form, we will get back to you within 24 hours!
| CAS Number | 110882-80-9 |
| Synonyms | 2-[(4-Ethylphenyl)-phenylacetyl]-indan-1,3-dione |
| Molecular Formula | C25H20O3 |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | 2-[2-(4-ethylphenyl)-2-phenylacetyl]indene-1,3-dione |
| InChI | InChI=1S/C25H20O3/c1-2-16-12-14-18(15-13-16)21(17-8-4-3-5-9-17)25(28)22-23(26)19-10-6-7-11-20(19)24(22)27/h3-15,21-22H,2H2,1H3 |
| InChIKey | SGHMQVUTLMJUFJ-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)C3C(=O)C4=CC=CC=C4C3=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |