For research use only. Not for therapeutic Use.
2-(4-Cyanophenyl)propanoic acid(CAT: L011879) is a high-purity aromatic carboxylic acid featuring a 4-cyanophenyl group and a propanoic acid moiety. This versatile compound is widely used as a key intermediate in pharmaceutical research and organic synthesis, particularly in the development of bioactive molecules such as nonsteroidal anti-inflammatory drugs (NSAIDs) and other therapeutic candidates. The presence of both the cyano group and carboxylic acid functionality enables targeted derivatization and chemical modifications, making it suitable for building complex molecular frameworks. 2-(4-Cyanophenyl)propanoic acid is ideal for medicinal chemistry applications, offering excellent stability, reactivity, and utility in precision-driven chemical transformations.
CAS Number | 362052-00-4 |
Molecular Formula | C10H9NO2 |
Purity | ≥95% |
IUPAC Name | 2-(4-cyanophenyl)propanoic acid |
InChI | InChI=1S/C10H9NO2/c1-7(10(12)13)9-4-2-8(6-11)3-5-9/h2-5,7H,1H3,(H,12,13) |
InChIKey | YSVNGBYVEJEXGO-UHFFFAOYSA-N |
SMILES | CC(C1=CC=C(C=C1)C#N)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |