2-(4-bromophenethoxy)tetrahydro-2H-pyran - CAS 79849-46-0
2-(4-bromophenethoxy)tetrahydro-2H-pyran(CAT: L000005) finds important applications in both organic and material chemistry. In organic chemistry, it acts as a valuable building block for the synthesis of diverse organic compounds. Its structure allows for the creation of specialized molecules with unique properties. In material chemistry, this compound plays a significant role in the development of polymers and materials with tailored characteristics, making it essential for the design of specific materials for various applications.
Catalog Number: L000005
CAS Number: 79849-46-0
Molecular Formula: C13H17BrO2
Molecular Weight:285.18
Purity: ≥95%
* For research use only. Not for human or veterinary use.
Property
Molecular Formula: | C13H17BrO2 |
---|---|
Molecular Weight | 285.18 |
Purity | ≥95% |
Computed Descriptor
IUPAC Name | 2-[2-(4-bromophenyl)ethoxy]oxane |
---|---|
InChI | InChI=1S/C13H17BrO2/c14-12-6-4-11(5-7-12)8-10-16-13-3-1-2-9-15-13/h4-7,13H,1-3,8-10H2 |
InChIKey | HGKHQEVNPHCQCH-UHFFFAOYSA-N |