2-(4-Amino-2-nitrophenyl)acetic acid - CAS 116435-81-5

2-(4-Amino-2-nitrophenyl)acetic acid (Cat.No:L004145) is a significant chemical compound with applications in pharmaceutical research. Its distinct structure, featuring an amino-nitrophenyl and acetic acid moiety, imparts unique reactivity. This compound serves as a valuable intermediate in the synthesis of specialized molecules with potential pharmaceutical activity.

Catalog Number: L004145

CAS Number: 116435-81-5

Molecular Formula: C8H8N2O4

Molecular Weight:196.16

Purity: ≥95%

* For research use only. Not for human or veterinary use.


Property

Molecular Formula: C8H8N2O4
Molecular Weight196.16
Purity≥95%

Computed Descriptor

IUPAC Name2-(4-amino-2-nitrophenyl)acetic acid
InChIInChI=1S/C8H8N2O4/c9-6-2-1-5(3-8(11)12)7(4-6)10(13)14/h1-2,4H,3,9H2,(H,11,12)
InChIKeyUBGCICBDSCTWSL-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1N)[N+](=O)[O-])CC(=O)O