For research use only. Not for therapeutic Use.
2-(3,5-Dimethylphenyl)-1,3,2-dioxaborinane (Cat.No:L004073) is a significant chemical compound used in various industrial applications. Its unique dioxaborinane structure, incorporating a 3,5-dimethylphenyl group, imparts specialized reactivity and properties. This compound serves as a crucial reagent in the synthesis of specialized organic molecules with applications in pharmaceutical and chemical research.
CAS Number | 436853-63-3 |
Molecular Formula | C11H15BO2 |
Purity | ≥95% |
IUPAC Name | 2-(3,5-dimethylphenyl)-1,3,2-dioxaborinane |
InChI | InChI=1S/C11H15BO2/c1-9-6-10(2)8-11(7-9)12-13-4-3-5-14-12/h6-8H,3-5H2,1-2H3 |
InChIKey | BBDURTGMHLDAQY-UHFFFAOYSA-N |
SMILES | B1(OCCCO1)C2=CC(=CC(=C2)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |