For research use only. Not for therapeutic Use.
2-(3,5-Difluorophenyl)-1,3,2-dioxaborinane(CAT: L000519)is a chemically important compound with versatile applications, primarily in organic and materials chemistry. Its action method involves its use as a valuable boron-containing reagent. In organic chemistry, it serves as a key component for the introduction of boron into various molecules, facilitating the synthesis of complex organic compounds. This compound is especially valuable in the formation of carbon-carbon bonds through cross-coupling reactions, contributing to the development of novel organic molecules.
CAS Number | 684648-47-3 |
Molecular Formula | C9H9BF2O2 |
Purity | ≥95% |
IUPAC Name | 2-(3,5-difluorophenyl)-1,3,2-dioxaborinane |
InChI | InChI=1S/C9H9BF2O2/c11-8-4-7(5-9(12)6-8)10-13-2-1-3-14-10/h4-6H,1-3H2 |
InChIKey | OPMWYZCBZAQSRG-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |