Home
>
Chemical Reagents>Organometallic Reagents> 2-(3,5-Dichloro-4-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
For research use only. Not for therapeutic Use.
2-(3,5-Dichloro-4-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (Cat.No:L003538) is a crucial compound in materials science and pharmaceutical research. Its unique boron-containing structure lends itself to various applications, from Suzuki-Miyaura cross-coupling reactions to the development of specialized materials. This compound stands as a key player in the advancement of both chemical synthesis methods and the creation of innovative materials, underscoring its significance in contemporary chemical research.
| CAS Number | 942069-69-4 |
| Molecular Formula | C13H17BCl2O3 |
| Purity | ≥95% |
| IUPAC Name | 2-(3,5-dichloro-4-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChI | InChI=1S/C13H17BCl2O3/c1-12(2)13(3,4)19-14(18-12)8-6-9(15)11(17-5)10(16)7-8/h6-7H,1-5H3 |
| InChIKey | SOSFOBFYDOBNDJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)Cl)OC)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |