For research use only. Not for therapeutic Use.
2-(3,4-Dimethoxyphenyl)-2-methylpropanenitrile is an organic compound featuring a nitrile group attached to a tertiary carbon, which is further substituted with a 3,4-dimethoxyphenyl group. This compound is significant in organic synthesis and medicinal chemistry, known for its potential biological activities and use as an intermediate in the development of various pharmaceuticals. The presence of methoxy groups enhances its solubility and reactivity, allowing for versatile chemical transformations. Its unique structure makes it valuable in the exploration of new therapeutic agents and bioactive compounds.
| CAS Number | 23023-16-7 |
| Molecular Formula | C12H15NO2 |
| Purity | ≥95% |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-2-methylpropanenitrile |
| InChI | InChI=1S/C12H15NO2/c1-12(2,8-13)9-5-6-10(14-3)11(7-9)15-4/h5-7H,1-4H3 |
| InChIKey | OEWDSMNBHDNSTP-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)C1=CC(=C(C=C1)OC)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |