For research use only. Not for therapeutic Use.
2-(3,4-Dihydroxyphenyl)-N-(prop-2-YN-1-YL)acetamide(Cat No.:L007473), is a chemical compound with potential applications in medicinal and pharmaceutical research. This molecule features a unique arrangement of atoms, including hydroxyphenyl and acetamide groups, making it of interest to scientists exploring its biological activities. Researchers study its interactions with biological targets, aiming to understand its potential therapeutic effects.
| CAS Number | 1332585-62-2 |
| Molecular Formula | C11H11NO3 |
| Purity | ≥95% |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-N-prop-2-ynylacetamide |
| InChI | InChI=1S/C11H11NO3/c1-2-5-12-11(15)7-8-3-4-9(13)10(14)6-8/h1,3-4,6,13-14H,5,7H2,(H,12,15) |
| InChIKey | VEGLLLDGXGAXKL-UHFFFAOYSA-N |
| SMILES | C#CCNC(=O)CC1=CC(=C(C=C1)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |