For research use only. Not for therapeutic Use.
2-(3-Methoxyphenyl)-2-methylpropanenitrile is an organic compound featuring a methoxy-substituted phenyl ring and a nitrile group attached to a methylpropanenitrile backbone. It is commonly used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. The methoxy group enhances the compound’s reactivity, while the nitrile group provides a site for further chemical transformations, such as hydrolysis or nucleophilic addition. This compound is valuable in the development of bioactive molecules for medicinal chemistry and drug discovery applications.
CAS Number | 17653-93-9 |
Synonyms | 2-(3-METHOXYPHENYL)-2-METHYLPROPANENITRILE |
Molecular Formula | C11H13NO |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 2-(3-methoxyphenyl)-2-methylpropanenitrile |
InChI | InChI=1S/C11H13NO/c1-11(2,8-12)9-5-4-6-10(7-9)13-3/h4-7H,1-3H3 |
InChIKey | YMUMJIHZRRIBPK-UHFFFAOYSA-N |
SMILES | CC(C)(C#N)C1=CC(=CC=C1)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |