For research use only. Not for therapeutic Use.
2-(3-Bromo-2-methylphenyl)acetonitrile(CAT: L022198) is an organic compound consisting of a brominated and methyl-substituted phenyl ring attached to an acetonitrile group (-CH2CN). The bromine atom at the 3-position and the methyl group at the 2-position on the phenyl ring influence the electronic properties and sterics of the molecule, making it useful as an intermediate in organic synthesis. The nitrile group can act as a reactive site for further functionalization, such as in the synthesis of pharmaceuticals, agrochemicals, or advanced materials. This compound is often employed in cross-coupling reactions or as a precursor for the development of more complex bioactive molecules.
CAS Number | 76574-42-0 |
Molecular Formula | C9H8BrN |
Purity | ≥95% |
IUPAC Name | 2-(3-bromo-2-methylphenyl)acetonitrile |
InChI | InChI=1S/C9H8BrN/c1-7-8(5-6-11)3-2-4-9(7)10/h2-4H,5H2,1H3 |
InChIKey | VBNCKBSHNGLORC-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |