For research use only. Not for therapeutic Use.
2-(3-Bromo-2-methoxyphenyl)acetonitrile(Cat No.:L006786). It consists of a phenyl acetonitrile backbone substituted with a bromine atom at the 3-position and a methoxy group at the 2-position of the phenyl ring. This compound is vital in organic synthesis, especially in the production of pharmaceuticals and agrochemicals. Its unique structure allows for diverse chemical transformations, making it valuable in the design and synthesis of complex molecules. Researchers utilize it as a key intermediate, contributing significantly to advancements in drug discovery and the development of specialized chemicals with specific biological or physical properties.
CAS Number | 1261602-72-5 |
Molecular Formula | C9H8BrNO |
Purity | ≥95% |
IUPAC Name | 2-(3-bromo-2-methoxyphenyl)acetonitrile |
InChI | InChI=1S/C9H8BrNO/c1-12-9-7(5-6-11)3-2-4-8(9)10/h2-4H,5H2,1H3 |
InChIKey | LHMNKBGKOIMKCU-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC=C1Br)CC#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |