Home
>
Chemical Reagents>Organic Building Blocks> 2-(2,4-Dichlorophenyl)cyclopropan-1-amine hydrochloride
For research use only. Not for therapeutic Use.
2-(2,4-Dichlorophenyl)cyclopropan-1-amine hydrochloride(Cat No.:L007305), is a chemical compound used in various research applications. This compound belongs to the class of organic compounds known as anilines, which are aromatic amines in which the amino group is substituted at the 2-position of aniline. The addition of the cyclopropane ring and chlorophenyl substituents imparts unique properties to this compound, making it valuable in pharmaceutical and agrochemical research. Researchers utilize it as a building block or intermediate in the synthesis of novel compounds for drug discovery and development. Its hydrochloride salt form enhances its stability and solubility, making it suitable for laboratory use.
| CAS Number | 1305712-16-6 |
| Molecular Formula | C9H10Cl3N |
| Purity | ≥95% |
| IUPAC Name | 2-(2,4-dichlorophenyl)cyclopropan-1-amine;hydrochloride |
| InChI | InChI=1S/C9H9Cl2N.ClH/c10-5-1-2-6(8(11)3-5)7-4-9(7)12;/h1-3,7,9H,4,12H2;1H |
| InChIKey | VBYWXDXPQBZRIB-UHFFFAOYSA-N |
| SMILES | C1C(C1N)C2=C(C=C(C=C2)Cl)Cl.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |