For research use only. Not for therapeutic Use.
2-(2,3-Dihydro-1H-inden-2-yl)acetic acid is a cyclic acetic acid derivative featuring an indane ring system, widely used in pharmaceutical and organic synthesis. Its structure, combining a 2,3-dihydroindene moiety with an acetic acid group, makes it a valuable intermediate in synthesizing bioactive molecules, especially in medicinal chemistry for developing anti-inflammatory and analgesic agents. The compound’s reactivity allows for versatile modifications, supporting its application in drug design, where stable cyclic frameworks are needed for receptor interaction studies and metabolic stability.
CAS Number | 37868-26-1 |
Molecular Formula | C11H12O2 |
Purity | ≥95% |
IUPAC Name | 2-(2,3-dihydro-1H-inden-2-yl)acetic acid |
InChI | InChI=1S/C11H12O2/c12-11(13)7-8-5-9-3-1-2-4-10(9)6-8/h1-4,8H,5-7H2,(H,12,13) |
InChIKey | TULDPXYHBFBRGW-UHFFFAOYSA-N |
SMILES | C1C(CC2=CC=CC=C21)CC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |