For research use only. Not for therapeutic Use.
2-(2-Thienyl)benzothiazole(Cat No.:L032464)is a heterocyclic compound combining a benzothiazole ring with a thienyl group at the 2-position. This structure is significant in pharmaceutical and material science research due to its potential bioactivity and electronic properties. It is often used as an intermediate in the synthesis of complex organic molecules, including potential therapeutic agents and organic semiconductors. The unique combination of sulfur-containing rings imparts distinctive chemical and physical properties, making 2-(2-Thienyl)benzothiazole valuable for advanced studies in drug discovery and optoelectronic material development.
CAS Number | 34243-38-4 |
Molecular Formula | C11H7NS2 |
Purity | ≥95% |
IUPAC Name | 2-thiophen-2-yl-1,3-benzothiazole |
InChI | InChI=1S/C11H7NS2/c1-2-5-9-8(4-1)12-11(14-9)10-6-3-7-13-10/h1-7H |
InChIKey | CNDVGJHQJAJTJK-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)N=C(S2)C3=CC=CS3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |