Home
>
Chemical Reagents>Heterocyclic Building Blocks> 2-(2-Methyl-4h-chromen-4-ylidene)malononitrile
For research use only. Not for therapeutic Use.
2-(2-Methyl-4H-chromen-4-ylidene)malononitrile is a heterocyclic compound featuring a chromenylidene core with a malononitrile group, commonly used in organic synthesis and material science. This compound’s structure, with both electron-withdrawing nitrile groups and a reactive chromene ring, makes it an ideal intermediate in the synthesis of complex molecules. It is particularly valuable in the development of fluorescent dyes, optical materials, and bioactive molecules. Its versatility extends to pharmaceutical research, where it aids in creating potential therapeutic agents and innovative materials.
| CAS Number | 15058-15-8 |
| Molecular Formula | C13H8N2O |
| Purity | ≥95% |
| IUPAC Name | 2-(2-methylchromen-4-ylidene)propanedinitrile |
| InChI | InChI=1S/C13H8N2O/c1-9-6-12(10(7-14)8-15)11-4-2-3-5-13(11)16-9/h2-6H,1H3 |
| InChIKey | GBJXKRIRSDZFGG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C#N)C#N)C2=CC=CC=C2O1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |