2-[2-(Methoxycarbonyl)phenyl]acetic acid - CAS 14736-49-3
2-[2-(Methoxycarbonyl)phenyl]acetic acid(CAT: L001006) is a compound with potential applications in organic synthesis and pharmaceutical research. The structure of the compound features a phenylacetic acid core with a methoxycarbonyl group attached to the phenyl ring. This compound may serve as a building block or intermediate in the synthesis of more complex molecules for various applications, including drug discovery and development.
![2-[2-(Methoxycarbonyl)phenyl]acetic acid](https://www.musechem.com/uploads/structure/14736-49-3.png)
Catalog Number: L001006
CAS Number: 14736-49-3
Molecular Formula: C10H10O4
Molecular Weight:194.18
Purity: ≥95%
* For research use only. Not for human or veterinary use.
Property
| Molecular Formula: | C10H10O4 |
|---|---|
| Molecular Weight | 194.18 |
| Purity | ≥95% |
Computed Descriptor
| IUPAC Name | 2-(2-methoxycarbonylphenyl)acetic acid |
|---|---|
| InChI | InChI=1S/C10H10O4/c1-14-10(13)8-5-3-2-4-7(8)6-9(11)12/h2-5H,6H2,1H3,(H,11,12) |
| InChIKey | UFUWTDVWSUXJEH-UHFFFAOYSA-N |