For research use only. Not for therapeutic Use.
2-(2-formylphenoxy)-N-methylacetamide(Cat No.:L007538), is a chemical compound characterized by an acetamide backbone substituted with a formylphenoxy group at the 2nd position and a methyl group attached to the nitrogen atom. This compound is significant in organic synthesis and medicinal chemistry, serving as a crucial intermediate for the preparation of various organic molecules, including pharmaceuticals and agrochemicals. Its unique structure and reactivity make it valuable for creating diverse organic compounds.
CAS Number | 216082-34-7 |
Molecular Formula | C10H11NO3 |
Purity | ≥95% |
IUPAC Name | 2-(2-formylphenoxy)-N-methylacetamide |
InChI | InChI=1S/C10H11NO3/c1-11-10(13)7-14-9-5-3-2-4-8(9)6-12/h2-6H,7H2,1H3,(H,11,13) |
InChIKey | XGBGUOKFVIRIKH-UHFFFAOYSA-N |
SMILES | CNC(=O)COC1=CC=CC=C1C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |