For research use only. Not for therapeutic Use.
2-(2-Chloropyridin-4-yl)acetonitrile(Cat No.:L025109)is a heteroaromatic compound composed of a pyridine ring substituted with a chlorine atom at the 2-position and a cyanomethyl group (–CH₂CN) at the 4-position. The combination of the electron-deficient pyridine ring, halogen, and nitrile functionality makes this molecule a valuable synthetic intermediate in medicinal chemistry and agrochemical development. The nitrile group serves as a handle for further chemical transformations, such as amide formation or reduction, while the chloro-substituent allows for cross-coupling or nucleophilic aromatic substitution, facilitating the construction of more complex heterocyclic and bioactive molecules.
CAS Number | 1000565-45-6 |
Molecular Formula | C7H5ClN2 |
Purity | ≥95% |
IUPAC Name | 2-(2-chloropyridin-4-yl)acetonitrile |
InChI | InChI=1S/C7H5ClN2/c8-7-5-6(1-3-9)2-4-10-7/h2,4-5H,1H2 |
InChIKey | JJUUSSZGXKUHJW-UHFFFAOYSA-N |
SMILES | C1=CN=C(C=C1CC#N)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |