For research use only. Not for therapeutic Use.
2-(2-Butoxyethoxy)ethyl acetate(Cat No.:M067613), also known as Butyl Carbitol Acetate, is a chemical compound with the molecular formula C10H20O4. It is composed of a butoxyethoxyethyl group attached to an acetate group. This compound is a clear, colorless liquid with a mild odor. Butyl Carbitol Acetate is primarily used as a solvent in various industrial applications, including coatings, paints, inks, and cleaners. Its solvency properties make it effective for dissolving a wide range of substances, while its relatively low volatility and slow evaporation rate contribute to its utility in formulations requiring extended drying times.
CAS Number | 124-17-4 |
Molecular Formula | C10H20O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(2-butoxyethoxy)ethyl acetate |
InChI | InChI=1S/C10H20O4/c1-3-4-5-12-6-7-13-8-9-14-10(2)11/h3-9H2,1-2H3 |
InChIKey | VXQBJTKSVGFQOL-UHFFFAOYSA-N |
SMILES | CCCCOCCOCCOC(=O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |