For research use only. Not for therapeutic Use.
2-(2-Bromo-4-fluorophenyl)-1,3-dioxolane (Cat.No:L003632) is a vital chemical compound used in pharmaceutical research. Its unique dioxolane ring structure, combined with the presence of bromine and fluorine, imparts distinctive properties for drug development. This compound serves as a key intermediate in the synthesis of specialized pharmaceutical agents, highlighting its significance in the quest for innovative drugs.
CAS Number | 773097-04-4 |
Molecular Formula | C9H8BrFO2 |
Purity | ≥95% |
IUPAC Name | 2-(2-bromo-4-fluorophenyl)-1,3-dioxolane |
InChI | InChI=1S/C9H8BrFO2/c10-8-5-6(11)1-2-7(8)9-12-3-4-13-9/h1-2,5,9H,3-4H2 |
InChIKey | RZLIJHGMYMELEK-UHFFFAOYSA-N |
SMILES | C1COC(O1)C2=C(C=C(C=C2)F)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |