For research use only. Not for therapeutic Use.
2-(2-Acetamidophenoxy)acetic acid(Cat No.:L018836)is an organic compound commonly used in pharmaceutical research and organic synthesis. It features an acetamido group attached to a phenoxyacetic acid backbone, making it a versatile intermediate in the development of bioactive molecules. This compound is often employed in the synthesis of drugs and other therapeutic agents, where its functional groups allow for diverse chemical modifications. With its ability to participate in various reactions, 2-(2-Acetamidophenoxy)acetic acid plays a crucial role in advancing medicinal chemistry and the creation of novel pharmaceuticals.
| CAS Number | 1798-12-5 |
| Molecular Formula | C10H11NO4 |
| Purity | ≥95% |
| IUPAC Name | 2-(2-acetamidophenoxy)acetic acid |
| InChI | InChI=1S/C10H11NO4/c1-7(12)11-8-4-2-3-5-9(8)15-6-10(13)14/h2-5H,6H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | FXAVGVSUKFCXDK-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=CC=C1OCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |