For research use only. Not for therapeutic Use.
2-[(1S,2S)-1-Ethyl-2-(phenylmethoxy)propyl]hydrazinecarboxaldehyde is a complex organic compound notable for its chiral hydrazine and aldehyde functionalities. This compound is significant in synthetic chemistry, often utilized as an intermediate in the preparation of bioactive molecules and pharmaceuticals. Its unique structure enables it to participate in various chemical reactions, including condensation and coupling reactions. Researchers explore its potential applications in medicinal chemistry, particularly in developing compounds targeting specific biological pathways or exhibiting therapeutic effects in various diseases.
CAS Number | 170985-85-0 |
Synonyms | [S-(R*,R*)]-2-[1-Ethyl-2-(phenylmethoxy)propyl]hydrazinecarboxaldehyde; |
Molecular Formula | C13H20N2O2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | N-[[(2S,3S)-2-phenylmethoxypentan-3-yl]amino]formamide |
InChI | InChI=1S/C13H20N2O2/c1-3-13(15-14-10-16)11(2)17-9-12-7-5-4-6-8-12/h4-8,10-11,13,15H,3,9H2,1-2H3,(H,14,16)/t11-,13-/m0/s1 |
InChIKey | LNEGZKZTVLXZFX-AAEUAGOBSA-N |
SMILES | CCC(C(C)OCC1=CC=CC=C1)NNC=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |