For research use only. Not for therapeutic Use.
2-(1-Methyl-1H-imidazol-4-yl)acetonitrile(Cat No.:L030862)is a versatile organic compound widely used in pharmaceutical research and organic synthesis. Featuring a methylated imidazole ring connected to an acetonitrile group, this compound serves as a key intermediate in the development of various bioactive molecules. It is particularly valuable in the synthesis of heterocyclic compounds and enzyme inhibitors. Its structure makes it a crucial component in creating novel therapeutic agents, contributing to advancements in medicinal chemistry and drug discovery, where it facilitates the exploration of new pharmacological pathways.
CAS Number | 41065-00-3 |
Molecular Formula | C6H7N3 |
Purity | ≥95% |
IUPAC Name | 2-(1-methylimidazol-4-yl)acetonitrile |
InChI | InChI=1S/C6H7N3/c1-9-4-6(2-3-7)8-5-9/h4-5H,2H2,1H3 |
InChIKey | AKRPAXQMAVWPSU-UHFFFAOYSA-N |
SMILES | CN1C=C(N=C1)CC#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |