For research use only. Not for therapeutic Use.
2,4,6-Trifluoro-s-triazine(CAT: R019736) is a highly reactive heterocyclic compound, featuring a symmetrical triazine ring substituted with three fluorine atoms. This electron-deficient aromatic structure makes it a powerful electrophile, commonly used as a coupling agent and intermediate in the synthesis of advanced organic materials, agrochemicals, and pharmaceuticals. Its high reactivity with nucleophiles, including amines and thiols, supports the construction of stable covalent linkages, such as in the derivatization of biomolecules or preparation of fluorinated polymers. 2,4,6-Trifluoro-s-triazine is particularly valuable in click chemistry, labeling strategies, and the development of functionalized ligands for material science and medicinal chemistry applications.
| CAS Number | 675-14-9 |
| Synonyms | 1,3,5-Trifluoro-2,4,6-triazine; 2,4,6-Trifluoro-1,3,5-triazine; 2,4,6-Trifluoro-s-triazine; 2,4,6-Trifluoro-sym-triazine; 2,4,6-Trifluorotriazine; Cyanuric Trifluoride; NSC 168386; Trifluoro-1,3,5-triazine; Trifluoro-s-triazine |
| Molecular Formula | C3F3N3 |
| Purity | ≥95% |
| Storage | Desiccate at -80C |
| IUPAC Name | 2,4,6-trifluoro-1,3,5-triazine |
| InChI | InChI=1S/C3F3N3/c4-1-7-2(5)9-3(6)8-1 |
| InChIKey | VMKJWLXVLHBJNK-UHFFFAOYSA-N |
| SMILES | C1(=NC(=NC(=N1)F)F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
