For research use only. Not for therapeutic Use.
(1S)-2,3-Dihydro-1H-indene-1-carboxylic acid(Cat No.:L007563), is a chiral organic compound with a molecular structure incorporating an indene ring system and a carboxylic acid functional group. Its stereochemistry, specifically the (1S) configuration, is crucial in various chemical and biological processes. This compound serves as a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals due to its unique structure and reactivity. Researchers use it as a building block in organic chemistry, enabling the creation of complex molecules with specific stereochemical arrangements, contributing significantly to the advancement of drug discovery and development processes.
CAS Number | 68000-22-6 |
Molecular Formula | C10H10O2 |
Purity | ≥95% |
IUPAC Name | (1S)-2,3-dihydro-1H-indene-1-carboxylic acid |
InChI | InChI=1S/C10H10O2/c11-10(12)9-6-5-7-3-1-2-4-8(7)9/h1-4,9H,5-6H2,(H,11,12)/t9-/m0/s1 |
InChIKey | JBQMFBWTKWOSQX-VIFPVBQESA-N |
SMILES | C1CC2=CC=CC=C2C1C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |