For research use only. Not for therapeutic Use.
1R,3R,αR-Deltamethrin(CAT: R018252) is a specific stereoisomer of deltamethrin, a highly effective pyrethroid insecticide known for its potent action against a wide range of insect pests. This compound works by disrupting the normal function of sodium channels in the nervous system of insects, leading to paralysis and death. The stereoisomer 1R,3R,αR-Deltamethrin is often favored for its enhanced insecticidal activity and environmental stability compared to other isomers, making it particularly valuable in agricultural pest control, public health initiatives, and residential pest management. It is used in minimal concentrations due to its high potency, ensuring effective pest control with reduced environmental impact. Additionally, this isomer is studied for its role in resistance management strategies and its potential effects on non-target species.
CAS Number | 55700-99-7 |
Synonyms | [1R-[1α(R*),3α]]-3-(2,2-Dibromoethenyl)-2,2-dimethyl-cyclopropanecarboxylic Acid Cyano(3-phenoxyphenyl)methyl Ester; NRDC 156A; RU 23938 |
Molecular Formula | C22H19Br2NO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [(R)-cyano-(3-phenoxyphenyl)methyl] (1R,3R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
InChI | InChI=1S/C22H19Br2NO3/c1-22(2)17(12-19(23)24)20(22)21(26)28-18(13-25)14-7-6-10-16(11-14)27-15-8-4-3-5-9-15/h3-12,17-18,20H,1-2H3/t17-,18-,20-/m0/s1 |
InChIKey | OWZREIFADZCYQD-BJLQDIEVSA-N |
SMILES | CC1([C@H]([C@H]1C(=O)O[C@@H](C#N)C2=CC(=CC=C2)OC3=CC=CC=C3)C=C(Br)Br)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |