For research use only. Not for therapeutic Use.
(1R)-Tenofovir amibufenamide（Cat No.:I043580）is a prodrug of tenofovir, an antiretroviral medication used to treat HIV and chronic hepatitis B. The (1R) configuration refers to the specific stereochemistry of the compound, which influences its pharmacokinetics and bioavailability. As a prodrug, it is designed to improve the absorption and delivery of tenofovir to its target tissues. Once metabolized, it releases tenofovir, which inhibits viral replication by blocking reverse transcriptase, an essential enzyme for the viral life cycle. (1R)-Tenofovir amibufenamide aims to enhance therapeutic efficacy and minimize side effects in patients.
| CAS Number | 1571076-15-7 |
| Synonyms | propan-2-yl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]-2-methylpropanoate |
| Molecular Formula | C22H31N6O5P |
| Purity | ≥95% |
| IUPAC Name | propan-2-yl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]-2-methylpropanoate |
| InChI | InChI=1S/C22H31N6O5P/c1-15(2)32-21(29)22(4,5)27-34(30,33-17-9-7-6-8-10-17)14-31-16(3)11-28-13-26-18-19(23)24-12-25-20(18)28/h6-10,12-13,15-16H,11,14H2,1-5H3,(H,27,30)(H2,23,24,25)/t16-,34?/m1/s1 |
| InChIKey | ORHSFGJQGPUCRR-LXAPUOBYSA-N |
| SMILES | C[C@H](CN1C=NC2=C(N=CN=C21)N)OCP(=O)(NC(C)(C)C(=O)OC(C)C)OC3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
