For research use only. Not for therapeutic Use.
(1R-cis)-Cyhalothric acid is a phytohormone found in plants, particularly in the genus Cyhalothrin. It plays a crucial role in regulating plant growth and development, including seed germination, root elongation, and flowering. Additionally, it exhibits pesticidal properties, serving as a natural defense mechanism against herbivores and pathogens. Understanding its biosynthesis and physiological functions can aid in developing sustainable agricultural practices and crop protection strategies.
| CAS Number | 76023-99-9 |
| Synonyms | (1R)-cis-3-[(Z)-2-Chloro-3,3,3-trifluoro-1-propenyl]-2,2-dimethylcyclopropanecarboxylic Acid; (1R,3R)- 3-[(1Z)-2-Chloro-3,3,3-trifluoro-1-propenyl]-2,2-dimethylcyclopropanecarboxylic Acid; [1R-[1α,3α(Z)]]-3-(2-Chloro-3,3,3-trifluoro-1-propenyl)-2,2-d |
| Molecular Formula | C9H10ClF3O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (1R,3R)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
| InChI | InChI=1S/C9H10ClF3O2/c1-8(2)4(6(8)7(14)15)3-5(10)9(11,12)13/h3-4,6H,1-2H3,(H,14,15)/b5-3-/t4-,6-/m0/s1 |
| InChIKey | SPVZAYWHHVLPBN-WREUKLMHSA-N |
| SMILES | CC1(C(C1C(=O)O)C=C(C(F)(F)F)Cl)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |