Home
>
Chemical Reagents>Organic Building Blocks> (1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethan-1-amine
For research use only. Not for therapeutic Use.
(1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethan-1-amine(Cat No.:L007543), is a chiral chemical compound featuring an amine group attached to a tetrahydronaphthalene ring. This compound holds significance in organic synthesis and medicinal chemistry, often used as a key intermediate for creating diverse organic molecules and potential drug candidates. Its specific stereochemistry and structural arrangement make it valuable for designing and developing pharmaceuticals with desired biological activities.
CAS Number | 1212104-62-5 |
Molecular Formula | C12H17N |
Purity | ≥95% |
IUPAC Name | (1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanamine |
InChI | InChI=1S/C12H17N/c1-9(13)11-7-6-10-4-2-3-5-12(10)8-11/h6-9H,2-5,13H2,1H3/t9-/m1/s1 |
InChIKey | YJZYMMDEDLLIIP-SECBINFHSA-N |
SMILES | CC(C1=CC2=C(CCCC2)C=C1)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |