1H,1H-Heptafluorobutyl Methacrylate(CAT: M060895) is a chemical compound of interest in polymer science, materials chemistry, and organic synthesis. Its action method involves its use as a monomer in the preparation of fluorinated polymers and copolymers. This compound’s unique structure, featuring fluorine atoms, imparts desirable properties to the resulting polymers, such as high chemical resistance and low surface energy.
Catalog Number | M060895 |
CAS Number | 13695-31-3 |
Molecular Formula | C8H7F7O2 |
Purity | 95% |
Storage | Store at RT |
IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutyl 2-methylprop-2-enoate |
InChI | InChI=1S/C8H7F7O2/c1-4(2)5(16)17-3-6(9,10)7(11,12)8(13,14)15/h1,3H2,2H3 |
InChIKey | VIEHKBXCWMMOOU-UHFFFAOYSA-N |
SMILES | CC(=C)C(=O)OCC(C(C(F)(F)F)(F)F)(F)F |