For research use only. Not for therapeutic Use.
1H-Pyrrole-2-carboxamide, 1-amino- (9CI) (Cat No.: M096229) is a heterocyclic organic compound consisting of a pyrrole ring substituted with a carboxamide group at the 2-position and an amino group at the nitrogen (1-position). This compound serves as a useful intermediate in the synthesis of bioactive molecules, especially in medicinal chemistry and heterocyclic drug design. Its dual functional groups—amide and amine—allow for diverse chemical modifications, making it suitable for constructing pharmacophores, peptide mimics, and small-molecule inhibitors in pharmaceutical research.
| CAS Number | 159326-69-9 |
| Molecular Formula | C5H7N3O |
| Purity | ≥95% |
| Storage | Store at -20℃ |
| IUPAC Name | 1-aminopyrrole-2-carboxamide |
| InChI | InChI=1S/C5H7N3O/c6-5(9)4-2-1-3-8(4)7/h1-3H,7H2,(H2,6,9) |
| InChIKey | WXHLTDFUEACLBE-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=C1)C(=O)N)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
