For research use only. Not for therapeutic Use.
5-Amino-1H-pyrazole-3-carboxylic acid is a heterocyclic compound commonly used in pharmaceutical research and organic synthesis. Its structure, featuring an amino group and a carboxylic acid on a pyrazole ring, makes it a versatile intermediate for developing bioactive molecules. This compound is particularly useful in the synthesis of drugs, enzyme inhibitors, and other therapeutic agents. Its reactivity allows for various chemical modifications, supporting advancements in medicinal chemistry and contributing to the design of novel pharmaceuticals and research compounds.
CAS Number | 124004-31-5 |
Molecular Formula | C4H5N3O2 |
Purity | ≥95% |
Storage | Desiccate at +4 ℃ |
IUPAC Name | 3-amino-1H-pyrazole-5-carboxylic acid |
InChI | InChI=1S/C4H5N3O2/c5-3-1-2(4(8)9)6-7-3/h1H,(H,8,9)(H3,5,6,7) |
InChIKey | ICASMSGEUGPHGI-UHFFFAOYSA-N |
SMILES | C1=C(NN=C1N)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |