For research use only. Not for therapeutic Use.
4,5-Dichloroindole is a chlorinated indole derivative known for its significance in organic synthesis and medicinal chemistry. This compound features two chlorine atoms at the 4 and 5 positions of the indole ring, enhancing its reactivity and biological activity. It serves as an important building block in the development of pharmaceuticals, particularly in the synthesis of various bioactive compounds. Additionally, 4,5-dichloroindole has been studied for its potential role in anticancer and antimicrobial applications, showcasing its versatility in research.
CAS Number | 122509-73-3 |
Molecular Formula | C8H5Cl2N |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4,5-dichloro-1H-indole |
InChI | InChI=1S/C8H5Cl2N/c9-6-1-2-7-5(8(6)10)3-4-11-7/h1-4,11H |
InChIKey | MUWQPYPTCAUUGM-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C2=C1NC=C2)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |