1H-Indazole-5-boronic acid(Cat No.:L007246), is a chemical compound used in organic synthesis and medicinal chemistry research. Its molecular formula is C7H7BN2O2. As a boronic acid derivative, it is essential in Suzuki-Miyaura cross-coupling reactions, a fundamental tool in the construction of complex organic molecules. Researchers utilize it to synthesize diverse pharmaceuticals, agrochemicals, and functional materials. Its versatile reactivity allows for modifications, enabling the creation of novel compounds. The boron atom’s presence provides unique selectivity in coupling reactions, making it valuable in drug discovery and material science, contributing significantly to advancements in organic chemistry.
Catalog Number | L007246 |
CAS Number | 338454-14-1 |
Molecular Formula | C7H7BN2O2 |
Purity | 95% |
Storage | 2-8°C |
IUPAC Name | 1H-indazol-5-ylboronic acid |
InChI | InChI=1S/C7H7BN2O2/c11-8(12)6-1-2-7-5(3-6)4-9-10-7/h1-4,11-12H,(H,9,10) |
InChIKey | CLVPGJWAMIADSY-UHFFFAOYSA-N |
SMILES | B(C1=CC2=C(C=C1)NN=C2)(O)O |