For research use only. Not for therapeutic Use.
1H-Indazole-3-acetic acid, methyl ester(CAT: M131616) is a high-purity heterocyclic compound widely utilized in pharmaceutical research and organic synthesis. Featuring an indazole core with a methyl ester-substituted acetic acid group, it serves as a critical intermediate for the development of bioactive molecules, small-molecule inhibitors, and therapeutic agents. Its structure allows for functionalization, making it valuable in medicinal chemistry for synthesizing complex derivatives and drug candidates. Known for its stability and versatility, 1H-Indazole-3-acetic acid, methyl ester supports innovative pathways in both academic and industrial research, providing precision and efficiency in the synthesis of advanced chemical and pharmaceutical products.
CAS Number | 131666-74-5 |
Molecular Formula | C10H10N2O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | methyl 2-(2H-indazol-3-yl)acetate |
InChI | InChI=1S/C10H10N2O2/c1-14-10(13)6-9-7-4-2-3-5-8(7)11-12-9/h2-5H,6H2,1H3,(H,11,12) |
InChIKey | GJIMTGCSEXYRCB-UHFFFAOYSA-N |
SMILES | COC(=O)CC1=C2C=CC=CC2=NN1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |