For research use only. Not for therapeutic Use.
1H-Imidazole-2-carboxylic acid (Cat No.: M078986) is a heterocyclic compound featuring an imidazole ring with a carboxylic acid substituent at the 2-position. This white to off-white crystalline solid is valued as a building block in pharmaceutical and peptide synthesis due to its dual functionality—basic nitrogen atoms and acidic carboxyl group. It participates in hydrogen bonding and metal coordination, making it useful in medicinal chemistry, catalysis, and materials science. Its structural resemblance to histidine derivatives also supports biochemical and enzyme interaction studies.
| CAS Number | 16042-25-4 |
| Molecular Formula | C4H4N2O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1H-imidazole-2-carboxylic acid |
| InChI | InChI=1S/C4H4N2O2/c7-4(8)3-5-1-2-6-3/h1-2H,(H,5,6)(H,7,8) |
| InChIKey | KYWMCFOWDYFYLV-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N1)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |