For research use only. Not for therapeutic Use.
1H-Benzotriazole-5-carboxylic acid is a heterocyclic compound featuring a benzotriazole ring with a carboxylic acid group at the 5-position. This unique structure imparts interesting chemical properties, making it valuable in organic synthesis and materials science. The carboxylic acid functionality enables various chemical transformations, while the benzotriazole moiety is known for its potential applications as a corrosion inhibitor and UV stabilizer. This compound may also serve as an intermediate in the development of pharmaceuticals and agrochemicals, facilitating further research in chemical applications.
CAS Number | 49636-03-5 |
Molecular Formula | C7H5N3O2 |
Purity | ≥95% |
IUPAC Name | 2H-benzotriazole-5-carboxylic acid |
InChI | InChI=1S/C7H5N3O2/c11-7(12)4-1-2-5-6(3-4)9-10-8-5/h1-3H,(H,11,12)(H,8,9,10) |
InChIKey | GUOVBFFLXKJFEE-UHFFFAOYSA-N |
SMILES | C1=CC2=NNN=C2C=C1C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |