For research use only. Not for therapeutic Use.
1H-Benzimidazole, 1-(2-methoxyethyl)-(9CI)(Cat No.:M100344) is a chemical compound belonging to the benzimidazole family, which is notable for its applications in pharmacology and agriculture. Structurally, it consists of a benzimidazole ring—an aromatic heterocycle containing nitrogen atoms—at positions 1 and 3, modified by the addition of a 2-methoxyethyl group at the first position. This modification introduces ethoxy and ethyl groups, enhancing the molecule’s solubility and potential interaction with various biological targets. Such derivatives are commonly investigated for their potential as pharmaceutical agents, including antifungal and antibacterial properties, and as intermediates in organic synthesis.
| CAS Number | 143656-17-1 |
| Synonyms | 1H-Benzimidazole,1-(2-ethoxyethyl)-(9CI) |
| Molecular Formula | C11H14N2O |
| Purity | ≥95% |
| Storage | Desiccate at -20C |
| IUPAC Name | 1-(2-ethoxyethyl)benzimidazole |
| InChI | InChI=1S/C11H14N2O/c1-2-14-8-7-13-9-12-10-5-3-4-6-11(10)13/h3-6,9H,2,7-8H2,1H3 |
| InChIKey | JBJUUEWWQLMAJH-UHFFFAOYSA-N |
| SMILES | CCOCCN1C=NC2=CC=CC=C21 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |