1H-Benzimidazole-2-methanamine, 7-fluoro- - CAS 394223-23-5

1H-Benzimidazole-2-methanamine, 7-fluoro-(CAT: L000823) holds significance in pharmaceutical and organic chemistry. As a key intermediate, it plays a crucial role in the synthesis of pharmaceutical compounds with potential therapeutic applications. The incorporation of a fluorine substituent enhances its biological activity and selectivity, making it valuable in drug development efforts. In organic chemistry, this compound serves as a building block for the creation of complex molecules, contributing to the development of fine chemicals and specialty materials.

Catalog Number: L000823

CAS Number: 394223-23-5

Molecular Formula: C8H8FN3

Molecular Weight:165.17

Purity: ≥95%

* For research use only. Not for human or veterinary use.


Property

Molecular Formula: C8H8FN3
Molecular Weight165.17
Purity≥95%

Computed Descriptor

IUPAC Name(4-fluoro-1H-benzimidazol-2-yl)methanamine
InChIInChI=1S/C8H8FN3/c9-5-2-1-3-6-8(5)12-7(4-10)11-6/h1-3H,4,10H2,(H,11,12)
InChIKeyXYMQPPPHJYPORZ-UHFFFAOYSA-N