For research use only. Not for therapeutic Use.
Prostaglandin F<sub>2α</sub> (PGF<sub>2α</sub>) drives luteolysis and smooth muscle contraction by activating the FP receptor. 17-<wbr></wbr>phenyl trinor PGF<sub>2α</sub> methyl ester is a lipophilic analog of 17-<wbr></wbr>phenyl trinor PGF<sub>2α</sub>, a potent agonist for the FP receptor. 17-<wbr></wbr>phenyl trinor PGF<sub>2α</sub> binds the FP receptor on ovine luteal cells with a relative potency of 756% compared to that of PGF<sub>2α</sub>. Esters of PGs serve as prodrugs, as they are efficiently hydrolyzed in certain tissues to generate the bioactive free acid.
| CAS Number | 38315-47-8 |
| Synonyms | Bimatoprost methyl ester;17-phenyl trinor PGF2α methyl ester |
| Molecular Formula | C24H34O5 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoate |
| InChI | InChI=1S/C24H34O5/c1-29-24(28)12-8-3-2-7-11-20-21(23(27)17-22(20)26)16-15-19(25)14-13-18-9-5-4-6-10-18/h2,4-7,9-10,15-16,19-23,25-27H,3,8,11-14,17H2,1H3/b7-2-,16-15+/t19-,20+,21+,22-,23+/m0/s1 |
| InChIKey | UQBYFURYGYNQLQ-FDBOBMRISA-N |
| SMILES | COC(=O)CCCC=CCC1C(CC(C1C=CC(CCC2=CC=CC=C2)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |