For research use only. Not for therapeutic Use.
17-DMAG hydrochloride(Cat No.:I003619)is a water-soluble derivative of geldanamycin and a potent inhibitor of heat shock protein 90 (Hsp90), a chaperone protein involved in stabilizing and folding various oncogenic proteins. By inhibiting Hsp90, 17-DMAG promotes the degradation of client proteins, leading to disruption of cancer cell growth and survival. It has shown promise in preclinical studies for treating a range of cancers, including breast cancer, prostate cancer, and leukemia. Its improved solubility over geldanamycin enhances its pharmacokinetic properties, making it a valuable candidate for cancer therapeutics and research.
| CAS Number | 467214-21-7 |
| Synonyms | [(3R,5S,6R,7S,8E,10S,11S,12Z,14E)-21-[2-(dimethylamino)ethylamino]-6-hydroxy-5,11-dimethoxy-3,7,9,15-tetramethyl-16,20,22-trioxo-17-azabicyclo[16.3.1]docosa-1(21),8,12,14,18-pentaen-10-yl] carbamate;hydrochloride |
| Molecular Formula | C₃₂H₄₈N₄O₈•HCl |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Solubility | DMSO: ≥ 50 mg/mL |
| Storage | 3 years -20℃ powder |
| IC50 | 62 nM |
| IUPAC Name | [(4E,6Z,8S,9S,10E,12S,13R,14S,16R)-19-[2-(dimethylamino)ethylamino]-13-hydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate;hydrochloride |
| InChI | InChI=1S/C32H48N4O8.ClH/c1-18-14-22-27(34-12-13-36(5)6)24(37)17-23(29(22)39)35-31(40)19(2)10-9-11-25(42-7)30(44-32(33)41)21(4)16-20(3)28(38)26(15-18)43-8;/h9-11,16-18,20,25-26,28,30,34,38H,12-15H2,1-8H3,(H2,33,41)(H,35,40);1H/b11-9-,19-10+,21-16+;/t18-,20+,25+,26+,28-,30+;/m1./s1 |
| InChIKey | DFSYBWLNYPEFJK-IHLRWNDRSA-N |
| SMILES | C[C@H]1C[C@@H]([C@@H]([C@H](/C=C(/[C@@H]([C@H](/C=C\C=C(\C(=O)NC2=CC(=O)C(=C(C1)C2=O)NCCN(C)C)/C)OC)OC(=O)N)\C)C)O)OC.Cl |
| Reference | <p style=/line-height:25px/> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |