For research use only. Not for therapeutic Use.
1,7-Dimethyluric acid is a metabolite of caffeine (Item No. <span class=/itemid/>14118</span>) produced by the action of xanthine oxidase on paraxanthine. It can be detected in urine as a biomarker of caffeine consumption.
| CAS Number | 33868-03-0 |
| Synonyms | 7,9-Dihydro-1,7-dimethyl-1H-purine-2,6,8(3H)-trione; |
| Molecular Formula | C7H8N4O3 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | -20°C |
| IUPAC Name | 1,7-dimethyl-3,9-dihydropurine-2,6,8-trione |
| InChI | InChI=1S/C7H8N4O3/c1-10-3-4(8-6(10)13)9-7(14)11(2)5(3)12/h1-2H3,(H,8,13)(H,9,14) |
| InChIKey | NOFNCLGCUJJPKU-UHFFFAOYSA-N |
| SMILES | CN1C2=C(NC1=O)NC(=O)N(C2=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |