For research use only. Not for therapeutic Use.
1,7-Dimethyluric Acid-d3 is a high-purity deuterated compound essential for advanced pharmaceutical and biochemical research. This isotopically labeled version of 1,7-Dimethyluric Acid, featuring three deuterium atoms, is crucial for studies involving purine metabolism, oxidative stress, and metabolic pathway analysis. Its stable isotope labeling ensures precise and reliable analytical results. With enhanced stability and consistency, it is suitable for various experimental setups. Ideal for biochemistry research and drug development, 1,7-Dimethyluric Acid-d3 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| CAS Number | 1189713-08-3 |
| Molecular Formula | C7H5D3N4O3 |
| Purity | ≥95% |
| IUPAC Name | 7-methyl-1-(trideuteriomethyl)-3,9-dihydropurine-2,6,8-trione |
| InChI | InChI=1S/C7H8N4O3/c1-10-3-4(8-6(10)13)9-7(14)11(2)5(3)12/h1-2H3,(H,8,13)(H,9,14)/i2D3 |
| InChIKey | NOFNCLGCUJJPKU-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=O)C2=C(NC(=O)N2C)NC1=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |