For research use only. Not for therapeutic Use.
1,7-Dihydrodibenzo[b,e][1,4]dioxino[2,3-d:7,8-d’]bis([1,2,3]triazole) (Cat.No:L003864) is a significant compound in organic synthesis. Its complex structure incorporates two dioxin rings fused with triazole moieties, offering unique reactivity. This compound serves as a valuable scaffold in the development of specialized molecules with diverse applications in materials science and pharmaceutical research.
CAS Number | 1276042-43-3 |
Molecular Formula | C12H6N6O2 |
Purity | ≥95% |
IUPAC Name | 2,12-dioxa-6,7,8,16,17,18-hexazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),3,5,8,10,13,15,18-octaene |
InChI | InChI=1S/C12H6N6O2/c1-5-6(14-17-13-5)2-10-9(1)19-11-3-7-8(16-18-15-7)4-12(11)20-10/h1-4H,(H,13,14,17)(H,15,16,18) |
InChIKey | VEYCGCHHIAFXIL-UHFFFAOYSA-N |
SMILES | C1=C2C(=CC3=NNN=C31)OC4=CC5=NNN=C5C=C4O2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |