For research use only. Not for therapeutic Use.
The compound named 1,6,7,8-Indolizinetetrol, octahedron-, (1S,6R,7R,8R,8aR)-(Cat No.:M011256) is a cyclic compound that features a saturated indolizine core attached with four hydroxyl (OH) groups. Indolizine is a bicyclic structure composed of a fused pyridine and pyrrolidine ring. This specific isomer has hydroxyl groups positioned strategically around the indolizine ring, potentially enhancing its solubility and reactivity. Its complex stereochemistry suggests potential biological activity or utility as a chiral building block in synthetic organic chemistry, possibly in pharmaceutical synthesis targeting specific molecular interactions due to its unique three-dimensional structure.
CAS Number | 107244-34-8 |
Synonyms | 1,6,7,8-Indolizinetetrol, octahydro-, (1S,6R,7R,8R,8aR)- |
Molecular Formula | C8H15NO4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (1S,6R,7R,8R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,6,7,8-tetrol |
InChI | InChI=1S/C8H15NO4/c10-4-1-2-9-3-5(11)7(12)8(13)6(4)9/h4-8,10-13H,1-3H2/t4-,5+,6+,7+,8+/m0/s1 |
InChIKey | JDVVGAQPNNXQDW-SLBCVNJHSA-N |
SMILES | C1CN2CC(C(C(C2C1O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |