For research use only. Not for therapeutic Use.
1,6-Dihydro-7H-pyrazolo[3,4-c]pyridin-7-one(Cat No.:L006770), is a fused heterocyclic compound. It is a bicyclic structure containing a pyrazole-pyridine backbone. This compound is significant in medicinal chemistry and drug discovery research, serving as a scaffold for designing potential pharmaceuticals. Its unique structure and potential interactions with biological targets make it valuable for creating diverse bioactive molecules. Researchers utilize it as a core template to synthesize novel compounds, exploring their pharmacological activities and contributing to the development of new drugs and therapeutic agents.
CAS Number | 76006-09-2 |
Molecular Formula | C6H5N3O |
Purity | ≥95% |
IUPAC Name | 1,6-dihydropyrazolo[3,4-c]pyridin-7-one |
InChI | InChI=1S/C6H5N3O/c10-6-5-4(1-2-7-6)3-8-9-5/h1-3H,(H,7,10)(H,8,9) |
InChIKey | RPXFCERITFUFCN-UHFFFAOYSA-N |
SMILES | C1=CNC(=O)C2=C1C=NN2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |