For research use only. Not for therapeutic Use.
1,6-Bis(mesyloxy)hexane (Cat No.:C000911) is an organic compound. It is a colorless to pale yellow liquid and belongs to the family of aliphatic compounds. This compound is used as a reagent and intermediate in organic synthesis, particularly in the production of various chemical compounds and pharmaceuticals. It contains two mesyloxy groups (methanesulfonyloxy) linked by a hexane chain. 1,6-Bis(siloxy)hexane is valuable in various chemical reactions to form different derivatives.
| CAS Number | 4239-24-1 |
| Synonyms | Methanesulfonic Acid Hexamethylene Ester; 1,6-Hexamethylene Dimesylate; 6-Methylsulfonyloxyhexyl Methylsulfonate; Hexasulfan; Hexasulphan; 1,6-Hexanediol Dimethanesulfonate; |
| Molecular Formula | C₈H₁₈O₆S₂ |
| Purity | ≥95% |
| Target | ADC Linker |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Appearance | White to Off-White Solid |
| Storage | -20°C |
| IUPAC Name | 6-methylsulfonyloxyhexyl methanesulfonate |
| InChI | InChI=1S/C8H18O6S2/c1-15(9,10)13-7-5-3-4-6-8-14-16(2,11)12/h3-8H2,1-2H3 |
| InChIKey | WZOJEWBBWCYINS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCCCCCCOS(=O)(=O)C |
| Reference | Ponti, M., et al.: Br. J. Cancer, 63, 743-747 (1991) |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |