For research use only. Not for therapeutic Use.
1,5-Dichloro-3-fluoro-2-(4-nitrophenoxy)benzene(Cat No.:M060986) is a complex organic molecule featuring a benzene ring substituted with chlorine, fluorine, and a 4-nitrophenoxy group. This structure imparts specific chemical properties such as reactivity and stability, making it useful in organic synthesis and materials science. The presence of electron-withdrawing groups like nitro and halogens (chlorine and fluorine) suggests applications in creating advanced polymers or conducting materials. The molecule’s unique substitution pattern may also be explored in the development of pharmaceuticals, pesticides, or as intermediates in the synthesis of more complex organic compounds.
CAS Number | 13738-63-1 |
Molecular Formula | C12H6Cl2FNO3 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 1,5-dichloro-3-fluoro-2-(4-nitrophenoxy)benzene |
InChI | InChI=1S/C12H6Cl2FNO3/c13-7-5-10(14)12(11(15)6-7)19-9-3-1-8(2-4-9)16(17)18/h1-6H |
InChIKey | MVHWKYHDYCGNQN-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2=C(C=C(C=C2Cl)Cl)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |