15-cis-Phytoene (Cat No.:R013262) is a chemical compound. It is a carotenoid pigment found in plants, algae, and some bacteria, playing a crucial role in photosynthesis and coloration. Its structure includes a series of conjugated double bonds that contribute to its coloration and ability to absorb light in the visible spectrum. 15-cis-Phytoene is considered a precursor to other carotenoids and is involved in the biosynthesis of various pigments in plants. Its importance in the plant kingdom’s biology underscores its role in photosynthetic processes and ecological interactions, supporting plant growth and survival.
Catalog Number | R013262 |
CAS Number | 13920-14-4 |
Synonyms | 15-cis-7,7′,8,8′,11,11′,12,12′-Octahydro-ψ,ψ-carotene; PhytoflORAL; 15-cis-7,7′,8,8′,11,11′,12,12′-Octahydro-lycopene; |
Molecular Formula | C40H64 |
Purity | 95% |
Storage | -86°C |
IUPAC Name | (6E,10E,14E,16Z,18E,22E,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,10,14,16,18,22,26,30-nonaene |
InChI | InChI=1S/C40H64/c1-33(2)19-13-23-37(7)27-17-31-39(9)29-15-25-35(5)21-11-12-22-36(6)26-16-30-40(10)32-18-28-38(8)24-14-20-34(3)4/h11-12,19-22,27-30H,13-18,23-26,31-32H2,1-10H3/b12-11-,35-21+,36-22+,37-27+,38-28+,39-29+,40-30+ |
InChIKey | YVLPJIGOMTXXLP-BHLJUDRVSA-N |
SMILES | CC(=CCCC(=CCCC(=CCCC(=CC=CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C)C)C)C |